SL-327
Inhibitor of MAP2K1/2 kinases activity in murine neuroblastoma cell line N2A
- Identifier
- CONSO00259
- Type
- chemical
- Author
- Kristian Kolpeja
https://orcid.org/0000-0001-9661-5277
References
Cross-references
- cas:305350-87-2
- chebi:CHEBI:92211
- inchi:InChI=1S/C16H12F3N3S/c17-16(18,19)14-4-2-1-3-12(14)13(9-20)15(22)23-11-7-5-10(21)6-8-11/h1-8H,21-22H2/b15-13+
- pubchem.compound:9549284
- smiles:C1=CC=C(C(=C1)C(=C(N)SC2=CC=C(C=C2)N)C#N)C(F)(F)F
Synonyms
| Synonym | Reference | Specificity |
| (2Z)-3-amino-3-[(4-aminophenyl)sulfanyl]-2-[2-(trifluoromethyl)phenyl]prop-2-enenitrile | pubchem.compound:9549284 | EXACT |
| (Z)-3-amino-3-(4-aminophenylthio)-2-(2-(trifluoromethyl)phenyl)acrylonitrile | pubchem.compound:9549284 | EXACT |
| 3-amino-3-(4-aminophenyl)sulfanyl-2-[2-(trifluoromethyl)phenyl]prop-2-enenitrile | pubchem.compound:9549284 | EXACT |
| 3-amino-3-[(4-aminophenyl)sulfanyl]-2-[2-(trifluoromethyl)phenyl]acrylonitrile | pubchem.compound:9549284 | EXACT |
| 3-amino-3-[(4-aminophenyl)thio]-2-[2-(trifluoromethyl)phenyl]-2-propenenitrile | pubchem.compound:9549284 | EXACT |
| 305350-87-2 | pubchem.compound:9549284 | EXACT |
| AKOS024456884 | pubchem.compound:9549284 | EXACT |
| AOB5954 | pubchem.compound:9549284 | EXACT |
| BC600460 | pubchem.compound:9549284 | EXACT |
| BCP05310 | pubchem.compound:9549284 | EXACT |
| BRD-K12244279-001-01-7 | pubchem.compound:9549284 | EXACT |
| Benzeneacetonitrile, alpha-[amino[(4-aminophenyl)thio]methylene]-2-(trifluoromethyl)- | pubchem.compound:9549284 | EXACT |
| CCG-206867 | pubchem.compound:9549284 | EXACT |
| CHEBI:92211 | pubchem.compound:9549284 | EXACT |
| CS-0910 | pubchem.compound:9549284 | EXACT |
| D04WPA | pubchem.compound:9549284 | EXACT |
| DTXSID90429549 | pubchem.compound:9549284 | EXACT |
| E/Z-a-[amino[(4-aminophenyl)thio]methylen]-2-(trifluoromethyl)benzeneacetonitrile | pubchem.compound:9549284 | EXACT |
| EC-000.2354 | pubchem.compound:9549284 | EXACT |
| EX-A1069 | pubchem.compound:9549284 | EXACT |
| GTPL6008 | pubchem.compound:9549284 | EXACT |
| HMS3229K18 | pubchem.compound:9549284 | EXACT |
| HMS3678M21 | pubchem.compound:9549284 | EXACT |
| HSCI1_000044 | pubchem.compound:9549284 | EXACT |
| HY-15437 | pubchem.compound:9549284 | EXACT |
| J-018001 | pubchem.compound:9549284 | EXACT |
| JLOXTZFYJNCPIS-FYWRMAATSA-N | pubchem.compound:9549284 | EXACT |
| K00090 | pubchem.compound:9549284 | EXACT |
| KB-80585 | pubchem.compound:9549284 | EXACT |
| LS-193345 | pubchem.compound:9549284 | EXACT |
| MEK1/2 Inhibitor | orcid:0000-0001-9439-5346 | BROAD |
| MFCD06411432 | pubchem.compound:9549284 | EXACT |
| MolPort-006-069-021 | pubchem.compound:9549284 | EXACT |
| NCGC00092290-01 | pubchem.compound:9549284 | EXACT |
| NCGC00092290-02 | pubchem.compound:9549284 | EXACT |
| SB19419 | pubchem.compound:9549284 | EXACT |
| SCHEMBL570317 | pubchem.compound:9549284 | EXACT |
| SCHEMBL570318 | pubchem.compound:9549284 | EXACT |
| SL 327 | pubchem.compound:9549284 | EXACT |
| SL-327 | pubchem.compound:9549284 | EXACT |
| SL327 | pubchem.compound:9549284 | EXACT |
| SL327, >=98% (HPLC), Mixture of E & Z isomers, solid | pubchem.compound:9549284 | EXACT |
| SW219839-1 | pubchem.compound:9549284 | EXACT |
| W-5333 | pubchem.compound:9549284 | EXACT |
| X3440 | pubchem.compound:9549284 | EXACT |
| Z-& E-a-(Amino-((4-aminophenyl)thio)methylene)-2-(trifluoromethyl)benzeneacetonitrile | pubchem.compound:9549284 | EXACT |
| Z-& E-alpha-(Amino-((4-aminophenyl)thio)methylene)-2-(trifluoromethyl)benzeneacetonitrile | pubchem.compound:9549284 | EXACT |
| ZINC1910234 | pubchem.compound:9549284 | EXACT |
| alpha-[Amino-(4-aminophenylthio)methylene)-2-(trifluoromethyl)phenylacetonitrile | pubchem.compound:9549284 | EXACT |
| alpha-{amino[(4-aminophenyl)thio]methylene}-2-(trifluoromethyl)benzeneacetonitrile | pubchem.compound:9549284 | EXACT |
| s1066 | pubchem.compound:9549284 | EXACT |