BAY61-3606
A cell-permeable imidazopyrimidine compound that acts a potent, ATP-competitive, reversible, and highly selective inhibitor of Syk tyrosine kinase activity (IC50 = 10 nM) with no inhibitory effect against Btk, Fyn, Itk, Lyn, and Src even at concentrations as high as 4.7 µM. Shown to inhibit Syk-mediated cellular functions in vitro and exhibit good oral bioavailability and in vivo effacacy in the treatment of various allgery and asthma conditions in rat models. Indirect inhibitory effect on GSK3B activity
- Identifier
- CONSO00236
- Type
- chemical
- Author
- Kristian Kolpeja
https://orcid.org/0000-0001-9661-5277
References
Cross-references
- cas:732983-37-8
- chebi:CHEBI:91426
- inchi:InChI=1S/C20H18N6O3/c1-28-15-6-5-12(10-16(15)29-2)14-11-17-22-8-9-26(17)20(24-14)25-19-13(18(21)27)4-3-7-23-19/h3-11H,1-2H3,(H2,21,27)(H,23,24,25)
- mesh:C477642
- pubchem.compound:10200390
- smiles:COC1=C(C=C(C=C1)C2=CC3=NC=CN3C(=N2)NC4=C(C=CC=N4)C(=O)N)OC
- wikidata:Q27163275
Synonyms
| Synonym | Reference | Specificity |
| 2-((7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl)amino)nicotinamide | pubchem.compound:10200390 | EXACT |
| 2-(7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-ylamino)nicotinamide hydrochloride | pubchem.compound:10200390 | EXACT |
| 2-[[7-(3,4-Dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]-3-pyridinecarboxamide | pubchem.compound:10200390 | EXACT |
| 2-[[7-(3,4-Dimethoxyphenyl)imidazo[1,2-c]pyrimidine-5-yl]amino]-3-pyridinecarboxamide | pubchem.compound:10200390 | EXACT |
| 2-[[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]pyridine-3-carboxamide | pubchem.compound:10200390 | EXACT |
| 3-Pyridinecarboxamide, 2-((7-(3,4-dimethoxyphenyl)imidazo(1,2-C)pyrimidin-5-yl)amino)- | pubchem.compound:10200390 | EXACT |
| 61G8S0H9KX | pubchem.compound:10200390 | EXACT |
| 732983-37-8 | pubchem.compound:10200390 | EXACT |
| A11320 | pubchem.compound:10200390 | EXACT |
| AC-29888 | pubchem.compound:10200390 | EXACT |
| ACN-053214 | pubchem.compound:10200390 | EXACT |
| AKOS030526888 | pubchem.compound:10200390 | EXACT |
| BAY 61-3606 | pubchem.compound:10200390 | EXACT |
| BAY 61-3606 HCl | pubchem.compound:10200390 | EXACT |
| BAY-61-360 | pubchem.compound:10200390 | EXACT |
| BAY-61-3606 free base | pubchem.compound:10200390 | EXACT |
| BAY-613606 | pubchem.compound:10200390 | EXACT |
| BAY61-3606 | pubchem.compound:10200390 | EXACT |
| BCP08946 | pubchem.compound:10200390 | EXACT |
| BDBM50325991 | pubchem.compound:10200390 | EXACT |
| BRD-K53281329-001-01-9 | pubchem.compound:10200390 | EXACT |
| CCG-102604 | pubchem.compound:10200390 | EXACT |
| CHEBI:91426 | pubchem.compound:10200390 | EXACT |
| CHEMBL1190711 | pubchem.compound:10200390 | EXACT |
| CHEMBL1242100 | pubchem.compound:10200390 | EXACT |
| CS-0235 | pubchem.compound:10200390 | EXACT |
| EX-A1437 | pubchem.compound:10200390 | EXACT |
| GTPL9693 | pubchem.compound:10200390 | EXACT |
| HY-76474 | pubchem.compound:10200390 | EXACT |
| J-507625 | pubchem.compound:10200390 | EXACT |
| KB-74859 | pubchem.compound:10200390 | EXACT |
| Kinome_3125 | pubchem.compound:10200390 | EXACT |
| NCGC00346945-01 | pubchem.compound:10200390 | EXACT |
| NCGC00346945-06 | pubchem.compound:10200390 | EXACT |
| RL04784 | pubchem.compound:10200390 | EXACT |
| SCHEMBL373774 | pubchem.compound:10200390 | EXACT |
| Syk inhibitor IV | pubchem.compound:10200390 | EXACT |
| UNII-61G8S0H9KX | pubchem.compound:10200390 | EXACT |
| ZINC3817793 | pubchem.compound:10200390 | EXACT |
| cc-526 | pubchem.compound:10200390 | EXACT |